About [(1R,2R)-2-(benzotriazol-1-yl)cyclohexyl]carbamic acid
[(1R,2R)-2-(benzotriazol-1-yl)cyclohexyl]carbamic acid (PubChem CID 138597703) has the molecular formula C13H16N4O2
and a molecular weight of 260.30 g/mol. Its IUPAC name is [(1R,2R)-2-(benzotriazol-1-yl)cyclohexyl]carbamic acid.
Molecular Properties
| Compound Name | [(1R,2R)-2-(benzotriazol-1-yl)cyclohexyl]carbamic acid |
| PubChem CID | 138597703 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | [(1R,2R)-2-(benzotriazol-1-yl)cyclohexyl]carbamic acid |
| SMILES | O=C(O)N[C@@H]1CCCC[C@H]1n1nnc2ccccc21 |
| InChI | InChI=1S/C13H16N4O2/c18-13(19)14-9-5-1-3-7-11(9)17-12-8-4-2-6-10(12)15-16-17/h2,4,6,8-9,11,14H,1,3,5,7H2,(H,18,19)/t9-,11-/m1/s1 |
| InChIKey | BFOMLUDJPBYBBC-MWLCHTKSSA-N |
| XLogP | 2.18 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(1R,2R)-2-(benzotriazol-1-yl)cyclohexyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2R)-2-(benzotriazol-1-yl)cyclohexyl]carbamic acid?
The IUPAC name of [(1R,2R)-2-(benzotriazol-1-yl)cyclohexyl]carbamic acid (CID 138597703) is [(1R,2R)-2-(benzotriazol-1-yl)cyclohexyl]carbamic acid.
What is the SMILES notation for [(1R,2R)-2-(benzotriazol-1-yl)cyclohexyl]carbamic acid?
The canonical SMILES for [(1R,2R)-2-(benzotriazol-1-yl)cyclohexyl]carbamic acid is O=C(O)N[C@@H]1CCCC[C@H]1n1nnc2ccccc21.
What is the InChIKey of [(1R,2R)-2-(benzotriazol-1-yl)cyclohexyl]carbamic acid?
The InChIKey is BFOMLUDJPBYBBC-MWLCHTKSSA-N. The full InChI is InChI=1S/C13H16N4O2/c18-13(19)14-9-5-1-3-7-11(9)17-12-8-4-2-6-10(12)15-16-17/h2,4,6,8-9,11,14H,1,3,5,7H2,(H,18,19)/t9-,11-/m1/s1.
What are the key properties of [(1R,2R)-2-(benzotriazol-1-yl)cyclohexyl]carbamic acid?
[(1R,2R)-2-(benzotriazol-1-yl)cyclohexyl]carbamic acid has a molecular weight of 260.30 g/mol, XLogP of 2.18, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2R)-2-(benzotriazol-1-yl)cyclohexyl]carbamic acid is sourced from PubChem (CID 138597703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).