C21H20F6N4O4 — CID 138598209
N-[(3S,4R)-4-[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-7-fluoro-3-oxo-1H-isoindol-2-yl]oxan-3-yl]-3,3,3-trifluoro-2,2-dimethylpropanamide (PubChem CID 138598209) has the molecular formula C21H20F6N4O4 and a molecular weight of 506.40 g/mol. Its IUPAC name is N-[(3S,4R)-4-[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-7-fluoro-3-oxo-1H-isoindol-2-yl]oxan-3-yl]-3,3,3-trifluoro-2,2-dimethylpropanamide.
| Compound Name | N-[(3S,4R)-4-[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-7-fluoro-3-oxo-1H-isoindol-2-yl]oxan-3-yl]-3,3,3-trifluoro-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 138598209 |
| Molecular Formula | C21H20F6N4O4 |
| Molecular Weight | 506.40 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | N-[(3S,4R)-4-[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-7-fluoro-3-oxo-1H-isoindol-2-yl]oxan-3-yl]-3,3,3-trifluoro-2,2-dimethylpropanamide |
| SMILES | CC(C)(C(=O)N[C@@H]1COCC[C@H]1N1Cc2c(F)cc(-c3nnc(C(F)F)o3)cc2C1=O)C(F)(F)F |
| InChI | InChI=1S/C21H20F6N4O4/c1-20(2,21(25,26)27)19(33)28-13-8-34-4-3-14(13)31-7-11-10(18(31)32)5-9(6-12(11)22)16-29-30-17(35-16)15(23)24/h5-6,13-15H,3-4,7-8H2,1-2H3,(H,28,33)/t13-,14-/m1/s1 |
| InChIKey | OPLPQALWFDEGGF-ZIAGYGMSSA-N |
| XLogP | 3.63 |
| TPSA | 97.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.40 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |