C19H25IN2O2 — CID 138602014
ethyl 2-[1-(3-iodopropyl)cyclohexyl]-3H-benzimidazole-5-carboxylate (PubChem CID 138602014) has the molecular formula C19H25IN2O2 and a molecular weight of 440.33 g/mol. Its IUPAC name is ethyl 2-[1-(3-iodopropyl)cyclohexyl]-3H-benzimidazole-5-carboxylate.
| Compound Name | ethyl 2-[1-(3-iodopropyl)cyclohexyl]-3H-benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 138602014 |
| Molecular Formula | C19H25IN2O2 |
| Molecular Weight | 440.33 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | ethyl 2-[1-(3-iodopropyl)cyclohexyl]-3H-benzimidazole-5-carboxylate |
| SMILES | CCOC(=O)c1ccc2nc(C3(CCCI)CCCCC3)[nH]c2c1 |
| InChI | InChI=1S/C19H25IN2O2/c1-2-24-17(23)14-7-8-15-16(13-14)22-18(21-15)19(11-6-12-20)9-4-3-5-10-19/h7-8,13H,2-6,9-12H2,1H3,(H,21,22) |
| InChIKey | LZOOYTNKEFVRQP-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.33 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|