C44H28FN4OP — CID 138605069
4-[4-[4-(3-diphenylphosphorylphenyl)naphthalen-1-yl]-6-(4-fluorophenyl)-1,3,5-triazin-2-yl]benzonitrile (PubChem CID 138605069) has the molecular formula C44H28FN4OP and a molecular weight of 678.71 g/mol. Its IUPAC name is 4-[4-[4-(3-diphenylphosphorylphenyl)naphthalen-1-yl]-6-(4-fluorophenyl)-1,3,5-triazin-2-yl]benzonitrile.
| Compound Name | 4-[4-[4-(3-diphenylphosphorylphenyl)naphthalen-1-yl]-6-(4-fluorophenyl)-1,3,5-triazin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 138605069 |
| Molecular Formula | C44H28FN4OP |
| Molecular Weight | 678.71 g/mol |
| Exact Mass | 678.20 |
| IUPAC Name | 4-[4-[4-(3-diphenylphosphorylphenyl)naphthalen-1-yl]-6-(4-fluorophenyl)-1,3,5-triazin-2-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2nc(-c3ccc(F)cc3)nc(-c3ccc(-c4cccc(P(=O)(c5ccccc5)c5ccccc5)c4)c4ccccc34)n2)cc1 |
| InChI | InChI=1S/C44H28FN4OP/c45-34-24-22-32(23-25-34)43-47-42(31-20-18-30(29-46)19-21-31)48-44(49-43)41-27-26-38(39-16-7-8-17-40(39)41)33-10-9-15-37(28-33)51(50,35-11-3-1-4-12-35)36-13-5-2-6-14-36/h1-28H |
| InChIKey | CVJXVUQCXPLYTF-UHFFFAOYSA-N |
| XLogP | 9.34 |
| TPSA | 79.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.71 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|