C17H18FN3O2S — CID 138605456
ethyl (1S)-2-[[(5S,7S)-7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]sulfanyl]cyclopropane-1-carboxylate (PubChem CID 138605456) has the molecular formula C17H18FN3O2S and a molecular weight of 347.42 g/mol. Its IUPAC name is ethyl (1S)-2-[[(5S,7S)-7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]sulfanyl]cyclopropane-1-carboxylate.
| Compound Name | ethyl (1S)-2-[[(5S,7S)-7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]sulfanyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 138605456 |
| Molecular Formula | C17H18FN3O2S |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | ethyl (1S)-2-[[(5S,7S)-7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]sulfanyl]cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CC1Sc1nc2n(n1)[C@H](c1ccccc1)C[C@@H]2F |
| InChI | InChI=1S/C17H18FN3O2S/c1-2-23-16(22)11-8-14(11)24-17-19-15-12(18)9-13(21(15)20-17)10-6-4-3-5-7-10/h3-7,11-14H,2,8-9H2,1H3/t11-,12+,13+,14?/m1/s1 |
| InChIKey | ZPTKBGCSXKQXCO-PYXFJAETSA-N |
| XLogP | 3.33 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |