C21H23ClN6O5 — CID 138608477
3-(4-chloro-5-cyano-2-pyridinyl)-1-[6-(dimethoxymethyl)-5-[(3-oxomorpholin-4-yl)methyl]-2-pyridinyl]-1-methylurea (PubChem CID 138608477) has the molecular formula C21H23ClN6O5 and a molecular weight of 474.91 g/mol. Its IUPAC name is 3-(4-chloro-5-cyano-2-pyridinyl)-1-[6-(dimethoxymethyl)-5-[(3-oxomorpholin-4-yl)methyl]-2-pyridinyl]-1-methylurea.
| Compound Name | 3-(4-chloro-5-cyano-2-pyridinyl)-1-[6-(dimethoxymethyl)-5-[(3-oxomorpholin-4-yl)methyl]-2-pyridinyl]-1-methylurea |
|---|---|
| PubChem CID | 138608477 |
| Molecular Formula | C21H23ClN6O5 |
| Molecular Weight | 474.91 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | 3-(4-chloro-5-cyano-2-pyridinyl)-1-[6-(dimethoxymethyl)-5-[(3-oxomorpholin-4-yl)methyl]-2-pyridinyl]-1-methylurea |
| SMILES | COC(OC)c1nc(N(C)C(=O)Nc2cc(Cl)c(C#N)cn2)ccc1CN1CCOCC1=O |
| InChI | InChI=1S/C21H23ClN6O5/c1-27(21(30)25-16-8-15(22)14(9-23)10-24-16)17-5-4-13(19(26-17)20(31-2)32-3)11-28-6-7-33-12-18(28)29/h4-5,8,10,20H,6-7,11-12H2,1-3H3,(H,24,25,30) |
| InChIKey | RCJHPHQHHQTDBN-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 129.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.91 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|