C25H29N7O3 — CID 146620255
3-[4-(cyclopropylamino)-5-prop-1-ynyl-2-pyridinyl]-1-[6-formyl-5-[(4-methyl-2-oxopiperazin-1-yl)methyl]-2-pyridinyl]-1-methylurea (PubChem CID 146620255) has the molecular formula C25H29N7O3 and a molecular weight of 475.55 g/mol. Its IUPAC name is 3-[4-(cyclopropylamino)-5-prop-1-ynyl-2-pyridinyl]-1-[6-formyl-5-[(4-methyl-2-oxopiperazin-1-yl)methyl]-2-pyridinyl]-1-methylurea.
| Compound Name | 3-[4-(cyclopropylamino)-5-prop-1-ynyl-2-pyridinyl]-1-[6-formyl-5-[(4-methyl-2-oxopiperazin-1-yl)methyl]-2-pyridinyl]-1-methylurea |
|---|---|
| PubChem CID | 146620255 |
| Molecular Formula | C25H29N7O3 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | 3-[4-(cyclopropylamino)-5-prop-1-ynyl-2-pyridinyl]-1-[6-formyl-5-[(4-methyl-2-oxopiperazin-1-yl)methyl]-2-pyridinyl]-1-methylurea |
| SMILES | CC#Cc1cnc(NC(=O)N(C)c2ccc(CN3CCN(C)CC3=O)c(C=O)n2)cc1NC1CC1 |
| InChI | InChI=1S/C25H29N7O3/c1-4-5-17-13-26-22(12-20(17)27-19-7-8-19)29-25(35)31(3)23-9-6-18(21(16-33)28-23)14-32-11-10-30(2)15-24(32)34/h6,9,12-13,16,19H,7-8,10-11,14-15H2,1-3H3,(H2,26,27,29,35) |
| InChIKey | ZORYQPPXEJDKEU-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|