C25H34N8O5 — CID 138633395
3-[5-cyano-4-(2-methoxyethylamino)-2-pyridinyl]-1-[6-(dimethoxymethyl)-5-[(4-methyl-2-oxopiperazin-1-yl)methyl]-2-pyridinyl]-1-methylurea (PubChem CID 138633395) has the molecular formula C25H34N8O5 and a molecular weight of 526.60 g/mol. Its IUPAC name is 3-[5-cyano-4-(2-methoxyethylamino)-2-pyridinyl]-1-[6-(dimethoxymethyl)-5-[(4-methyl-2-oxopiperazin-1-yl)methyl]-2-pyridinyl]-1-methylurea.
| Compound Name | 3-[5-cyano-4-(2-methoxyethylamino)-2-pyridinyl]-1-[6-(dimethoxymethyl)-5-[(4-methyl-2-oxopiperazin-1-yl)methyl]-2-pyridinyl]-1-methylurea |
|---|---|
| PubChem CID | 138633395 |
| Molecular Formula | C25H34N8O5 |
| Molecular Weight | 526.60 g/mol |
| Exact Mass | 526.27 |
| IUPAC Name | 3-[5-cyano-4-(2-methoxyethylamino)-2-pyridinyl]-1-[6-(dimethoxymethyl)-5-[(4-methyl-2-oxopiperazin-1-yl)methyl]-2-pyridinyl]-1-methylurea |
| SMILES | COCCNc1cc(NC(=O)N(C)c2ccc(CN3CCN(C)CC3=O)c(C(OC)OC)n2)ncc1C#N |
| InChI | InChI=1S/C25H34N8O5/c1-31-9-10-33(22(34)16-31)15-17-6-7-21(30-23(17)24(37-4)38-5)32(2)25(35)29-20-12-19(27-8-11-36-3)18(13-26)14-28-20/h6-7,12,14,24H,8-11,15-16H2,1-5H3,(H2,27,28,29,35) |
| InChIKey | OVXJFYHMLOLDFR-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 145.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.60 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|