C22H32FNO3 — CID 138614169
tert-butyl 4-acetyl-4-(2-fluoro-4-methyl-6-propylphenyl)piperidine-1-carboxylate (PubChem CID 138614169) has the molecular formula C22H32FNO3 and a molecular weight of 377.50 g/mol. Its IUPAC name is tert-butyl 4-acetyl-4-(2-fluoro-4-methyl-6-propylphenyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-acetyl-4-(2-fluoro-4-methyl-6-propylphenyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 138614169 |
| Molecular Formula | C22H32FNO3 |
| Molecular Weight | 377.50 g/mol |
| Exact Mass | 377.24 |
| IUPAC Name | tert-butyl 4-acetyl-4-(2-fluoro-4-methyl-6-propylphenyl)piperidine-1-carboxylate |
| SMILES | CCCc1cc(C)cc(F)c1C1(C(C)=O)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C22H32FNO3/c1-7-8-17-13-15(2)14-18(23)19(17)22(16(3)25)9-11-24(12-10-22)20(26)27-21(4,5)6/h13-14H,7-12H2,1-6H3 |
| InChIKey | VITLUTFPQCRGOU-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.50 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |