C23H32N2O4 — CID 138616715
methyl 1-[2-(2-tert-butylanilino)-2-oxoacetyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-4-carboxylate (PubChem CID 138616715) has the molecular formula C23H32N2O4 and a molecular weight of 400.52 g/mol. Its IUPAC name is methyl 1-[2-(2-tert-butylanilino)-2-oxoacetyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-4-carboxylate.
| Compound Name | methyl 1-[2-(2-tert-butylanilino)-2-oxoacetyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-4-carboxylate |
|---|---|
| PubChem CID | 138616715 |
| Molecular Formula | C23H32N2O4 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | methyl 1-[2-(2-tert-butylanilino)-2-oxoacetyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-4-carboxylate |
| SMILES | COC(=O)C1CCN(C(=O)C(=O)Nc2ccccc2C(C)(C)C)C2CCCCC12 |
| InChI | InChI=1S/C23H32N2O4/c1-23(2,3)17-10-6-7-11-18(17)24-20(26)21(27)25-14-13-16(22(28)29-4)15-9-5-8-12-19(15)25/h6-7,10-11,15-16,19H,5,8-9,12-14H2,1-4H3,(H,24,26) |
| InChIKey | GKTVJLOKRGAUKY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|