C16H16Cl2N4O4 — CID 138620035
1-N',2-N'-bis(2-chloro-3-methoxyphenyl)ethanedihydrazide (PubChem CID 138620035) has the molecular formula C16H16Cl2N4O4 and a molecular weight of 399.23 g/mol. Its IUPAC name is 1-N',2-N'-bis(2-chloro-3-methoxyphenyl)ethanedihydrazide.
| Compound Name | 1-N',2-N'-bis(2-chloro-3-methoxyphenyl)ethanedihydrazide |
|---|---|
| PubChem CID | 138620035 |
| Molecular Formula | C16H16Cl2N4O4 |
| Molecular Weight | 399.23 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | 1-N',2-N'-bis(2-chloro-3-methoxyphenyl)ethanedihydrazide |
| SMILES | COc1cccc(NNC(=O)C(=O)NNc2cccc(OC)c2Cl)c1Cl |
| InChI | InChI=1S/C16H16Cl2N4O4/c1-25-11-7-3-5-9(13(11)17)19-21-15(23)16(24)22-20-10-6-4-8-12(26-2)14(10)18/h3-8,19-20H,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | WKCWRZRPHFRWLP-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.23 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|