C14H20ClNO4 — CID 177312801
N-(2-chloro-3-methoxyphenyl)-3,3-diethoxypropanamide (PubChem CID 177312801) has the molecular formula C14H20ClNO4 and a molecular weight of 301.77 g/mol. Its IUPAC name is N-(2-chloro-3-methoxyphenyl)-3,3-diethoxypropanamide.
| Compound Name | N-(2-chloro-3-methoxyphenyl)-3,3-diethoxypropanamide |
|---|---|
| PubChem CID | 177312801 |
| Molecular Formula | C14H20ClNO4 |
| Molecular Weight | 301.77 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | N-(2-chloro-3-methoxyphenyl)-3,3-diethoxypropanamide |
| SMILES | CCOC(CC(=O)Nc1cccc(OC)c1Cl)OCC |
| InChI | InChI=1S/C14H20ClNO4/c1-4-19-13(20-5-2)9-12(17)16-10-7-6-8-11(18-3)14(10)15/h6-8,13H,4-5,9H2,1-3H3,(H,16,17) |
| InChIKey | BGZMSRKFTURCLY-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.77 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|