C18H23ClO4 — CID 138623466
ethyl (E,2S)-5-(4-chlorophenyl)-2-(3-formyloxypropyl)-2-methylpent-4-enoate (PubChem CID 138623466) has the molecular formula C18H23ClO4 and a molecular weight of 338.83 g/mol. Its IUPAC name is ethyl (E,2S)-5-(4-chlorophenyl)-2-(3-formyloxypropyl)-2-methylpent-4-enoate.
| Compound Name | ethyl (E,2S)-5-(4-chlorophenyl)-2-(3-formyloxypropyl)-2-methylpent-4-enoate |
|---|---|
| PubChem CID | 138623466 |
| Molecular Formula | C18H23ClO4 |
| Molecular Weight | 338.83 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | ethyl (E,2S)-5-(4-chlorophenyl)-2-(3-formyloxypropyl)-2-methylpent-4-enoate |
| SMILES | CCOC(=O)[C@](C)(C/C=C/c1ccc(Cl)cc1)CCCOC=O |
| InChI | InChI=1S/C18H23ClO4/c1-3-23-17(21)18(2,12-5-13-22-14-20)11-4-6-15-7-9-16(19)10-8-15/h4,6-10,14H,3,5,11-13H2,1-2H3/b6-4+/t18-/m1/s1 |
| InChIKey | ODIVXSTYYIVCFY-MJICGBHWSA-N |
| XLogP | 4.27 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.83 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|