C29H44O3 — CID 138625353
2-[(1R,5S,13S,15R,17S)-10-ethoxy-17-ethyl-14-methoxy-15-pentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10-trienyl]-3,3-dimethylbutan-2-ol (PubChem CID 138625353) has the molecular formula C29H44O3 and a molecular weight of 440.67 g/mol. Its IUPAC name is 2-[(1R,5S,13S,15R,17S)-10-ethoxy-17-ethyl-14-methoxy-15-pentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10-trienyl]-3,3-dimethylbutan-2-ol.
| Compound Name | 2-[(1R,5S,13S,15R,17S)-10-ethoxy-17-ethyl-14-methoxy-15-pentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10-trienyl]-3,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 138625353 |
| Molecular Formula | C29H44O3 |
| Molecular Weight | 440.67 g/mol |
| Exact Mass | 440.33 |
| IUPAC Name | 2-[(1R,5S,13S,15R,17S)-10-ethoxy-17-ethyl-14-methoxy-15-pentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10-trienyl]-3,3-dimethylbutan-2-ol |
| SMILES | CCOc1ccc2c3c1C[C@@H]1C(OC)[C@H](C(C)(O)C(C)(C)C)C[C@@]4(CC)[C@@H](CCC[C@@]314)C2 |
| InChI | InChI=1S/C29H44O3/c1-8-28-17-22(27(6,30)26(3,4)5)25(31-7)21-16-20-23(32-9-2)13-12-18-15-19(28)11-10-14-29(21,28)24(18)20/h12-13,19,21-22,25,30H,8-11,14-17H2,1-7H3/t19-,21+,22+,25?,27?,28-,29-/m0/s1 |
| InChIKey | YCUSFIVGAUCLGE-DMSPGFIGSA-N |
| XLogP | 6.08 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.67 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |