C22H18F7N7O3 — CID 138625781
3-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-6-[1-methyl-4-[1-(2,2,3,3,3-pentafluoropropanoyl)piperidin-4-yl]pyrazol-3-yl]-7H-pyrrolo[3,4-b]pyridin-5-one (PubChem CID 138625781) has the molecular formula C22H18F7N7O3 and a molecular weight of 561.42 g/mol. Its IUPAC name is 3-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-6-[1-methyl-4-[1-(2,2,3,3,3-pentafluoropropanoyl)piperidin-4-yl]pyrazol-3-yl]-7H-pyrrolo[3,4-b]pyridin-5-one.
| Compound Name | 3-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-6-[1-methyl-4-[1-(2,2,3,3,3-pentafluoropropanoyl)piperidin-4-yl]pyrazol-3-yl]-7H-pyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 138625781 |
| Molecular Formula | C22H18F7N7O3 |
| Molecular Weight | 561.42 g/mol |
| Exact Mass | 561.14 |
| IUPAC Name | 3-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-6-[1-methyl-4-[1-(2,2,3,3,3-pentafluoropropanoyl)piperidin-4-yl]pyrazol-3-yl]-7H-pyrrolo[3,4-b]pyridin-5-one |
| SMILES | Cn1cc(C2CCN(C(=O)C(F)(F)C(F)(F)F)CC2)c(N2Cc3ncc(-c4nnc(C(F)F)o4)cc3C2=O)n1 |
| InChI | InChI=1S/C22H18F7N7O3/c1-34-8-13(10-2-4-35(5-3-10)20(38)21(25,26)22(27,28)29)16(33-34)36-9-14-12(19(36)37)6-11(7-30-14)17-31-32-18(39-17)15(23)24/h6-8,10,15H,2-5,9H2,1H3 |
| InChIKey | FFPHYRKCXNUZFE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 110.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.42 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|