C25H18F8N4O3 — CID 138625965
6-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-[(3S,4S)-4-(4-fluorophenyl)-1-(2,2,3,3,3-pentafluoropropanoyl)piperidin-3-yl]-3H-isoindol-1-one (PubChem CID 138625965) has the molecular formula C25H18F8N4O3 and a molecular weight of 574.43 g/mol. Its IUPAC name is 6-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-[(3S,4S)-4-(4-fluorophenyl)-1-(2,2,3,3,3-pentafluoropropanoyl)piperidin-3-yl]-3H-isoindol-1-one.
| Compound Name | 6-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-[(3S,4S)-4-(4-fluorophenyl)-1-(2,2,3,3,3-pentafluoropropanoyl)piperidin-3-yl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 138625965 |
| Molecular Formula | C25H18F8N4O3 |
| Molecular Weight | 574.43 g/mol |
| Exact Mass | 574.13 |
| IUPAC Name | 6-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-[(3S,4S)-4-(4-fluorophenyl)-1-(2,2,3,3,3-pentafluoropropanoyl)piperidin-3-yl]-3H-isoindol-1-one |
| SMILES | O=C1c2cc(-c3nnc(C(F)F)o3)ccc2CN1[C@@H]1CN(C(=O)C(F)(F)C(F)(F)F)CC[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C25H18F8N4O3/c26-15-5-3-12(4-6-15)16-7-8-36(23(39)24(29,30)25(31,32)33)11-18(16)37-10-14-2-1-13(9-17(14)22(37)38)20-34-35-21(40-20)19(27)28/h1-6,9,16,18-19H,7-8,10-11H2/t16-,18+/m0/s1 |
| InChIKey | VKLKNXFBTXELGL-FUHWJXTLSA-N |
| XLogP | 5.35 |
| TPSA | 79.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.43 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|