C30H52O3 — CID 138626192
(3S,8S,9S,10S,13R,14S)-17-[(2R)-5-ethyl-5-hydroxyheptan-2-yl]-10-(methoxymethyl)-3,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 138626192) has the molecular formula C30H52O3 and a molecular weight of 460.74 g/mol. Its IUPAC name is (3S,8S,9S,10S,13R,14S)-17-[(2R)-5-ethyl-5-hydroxyheptan-2-yl]-10-(methoxymethyl)-3,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8S,9S,10S,13R,14S)-17-[(2R)-5-ethyl-5-hydroxyheptan-2-yl]-10-(methoxymethyl)-3,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 138626192 |
| Molecular Formula | C30H52O3 |
| Molecular Weight | 460.74 g/mol |
| Exact Mass | 460.39 |
| IUPAC Name | (3S,8S,9S,10S,13R,14S)-17-[(2R)-5-ethyl-5-hydroxyheptan-2-yl]-10-(methoxymethyl)-3,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CCC(O)(CC)CC[C@@H](C)C1CC[C@H]2[C@@H]3CC=C4C[C@@](C)(O)CC[C@]4(COC)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C30H52O3/c1-7-29(32,8-2)16-13-21(3)24-11-12-25-23-10-9-22-19-27(4,31)17-18-30(22,20-33-6)26(23)14-15-28(24,25)5/h9,21,23-26,31-32H,7-8,10-20H2,1-6H3/t21-,23+,24?,25+,26+,27+,28-,30-/m1/s1 |
| InChIKey | XNFAORIWKFNBFH-NIXOBZNWSA-N |
| XLogP | 6.91 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.74 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|