C27H54INO6 — CID 138627701
2-[4-[5-[5-(1-aminoethoxy)-3,3-dimethylpentan-2-yl]oxy-2-iodo-3,3-dimethylhexan-2-yl]oxy-2-methylbutan-2-yl]oxyethyl propanoate (PubChem CID 138627701) has the molecular formula C27H54INO6 and a molecular weight of 615.63 g/mol. Its IUPAC name is 2-[4-[5-[5-(1-aminoethoxy)-3,3-dimethylpentan-2-yl]oxy-2-iodo-3,3-dimethylhexan-2-yl]oxy-2-methylbutan-2-yl]oxyethyl propanoate.
| Compound Name | 2-[4-[5-[5-(1-aminoethoxy)-3,3-dimethylpentan-2-yl]oxy-2-iodo-3,3-dimethylhexan-2-yl]oxy-2-methylbutan-2-yl]oxyethyl propanoate |
|---|---|
| PubChem CID | 138627701 |
| Molecular Formula | C27H54INO6 |
| Molecular Weight | 615.63 g/mol |
| Exact Mass | 615.30 |
| IUPAC Name | 2-[4-[5-[5-(1-aminoethoxy)-3,3-dimethylpentan-2-yl]oxy-2-iodo-3,3-dimethylhexan-2-yl]oxy-2-methylbutan-2-yl]oxyethyl propanoate |
| SMILES | CCC(=O)OCCOC(C)(C)CCOC(C)(I)C(C)(C)CC(C)OC(C)C(C)(C)CCOC(C)N |
| InChI | InChI=1S/C27H54INO6/c1-12-23(30)32-17-18-33-26(9,10)14-16-34-27(11,28)25(7,8)19-20(2)35-21(3)24(5,6)13-15-31-22(4)29/h20-22H,12-19,29H2,1-11H3 |
| InChIKey | OLWDGYQNTLVJNI-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.63 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|