About 5-(1-aminoethoxy)-2-(3-methoxy-3-methylbutoxy)-2,4,4-trimethylhexan-3-one
5-(1-aminoethoxy)-2-(3-methoxy-3-methylbutoxy)-2,4,4-trimethylhexan-3-one (PubChem CID 134400819) has the molecular formula C17H35NO4
and a molecular weight of 317.47 g/mol. Its IUPAC name is 5-(1-aminoethoxy)-2-(3-methoxy-3-methylbutoxy)-2,4,4-trimethylhexan-3-one.
Molecular Properties
| Compound Name | 5-(1-aminoethoxy)-2-(3-methoxy-3-methylbutoxy)-2,4,4-trimethylhexan-3-one |
| PubChem CID | 134400819 |
| Molecular Formula | C17H35NO4 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.26 |
| IUPAC Name | 5-(1-aminoethoxy)-2-(3-methoxy-3-methylbutoxy)-2,4,4-trimethylhexan-3-one |
| SMILES | COC(C)(C)CCOC(C)(C)C(=O)C(C)(C)C(C)OC(C)N |
| InChI | InChI=1S/C17H35NO4/c1-12(22-13(2)18)16(5,6)14(19)17(7,8)21-11-10-15(3,4)20-9/h12-13H,10-11,18H2,1-9H3 |
| InChIKey | GENNRGUFNKUOKB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 5-(1-aminoethoxy)-2-(3-methoxy-3-methylbutoxy)-2,4,4-trimethylhexan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-aminoethoxy)-2-(3-methoxy-3-methylbutoxy)-2,4,4-trimethylhexan-3-one?
The IUPAC name of 5-(1-aminoethoxy)-2-(3-methoxy-3-methylbutoxy)-2,4,4-trimethylhexan-3-one (CID 134400819) is 5-(1-aminoethoxy)-2-(3-methoxy-3-methylbutoxy)-2,4,4-trimethylhexan-3-one.
What is the SMILES notation for 5-(1-aminoethoxy)-2-(3-methoxy-3-methylbutoxy)-2,4,4-trimethylhexan-3-one?
The canonical SMILES for 5-(1-aminoethoxy)-2-(3-methoxy-3-methylbutoxy)-2,4,4-trimethylhexan-3-one is COC(C)(C)CCOC(C)(C)C(=O)C(C)(C)C(C)OC(C)N.
What is the InChIKey of 5-(1-aminoethoxy)-2-(3-methoxy-3-methylbutoxy)-2,4,4-trimethylhexan-3-one?
The InChIKey is GENNRGUFNKUOKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H35NO4/c1-12(22-13(2)18)16(5,6)14(19)17(7,8)21-11-10-15(3,4)20-9/h12-13H,10-11,18H2,1-9H3.
What are the key properties of 5-(1-aminoethoxy)-2-(3-methoxy-3-methylbutoxy)-2,4,4-trimethylhexan-3-one?
5-(1-aminoethoxy)-2-(3-methoxy-3-methylbutoxy)-2,4,4-trimethylhexan-3-one has a molecular weight of 317.47 g/mol, XLogP of 2.90, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-aminoethoxy)-2-(3-methoxy-3-methylbutoxy)-2,4,4-trimethylhexan-3-one is sourced from PubChem (CID 134400819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).