C25H22FN5O3 — CID 138628712
7-amino-1-[4-(2-fluorophenoxy)phenyl]-3-[(3R)-1-prop-2-enoylpyrrolidin-3-yl]-5H-pyrrolo[2,3-d]pyridazin-4-one (PubChem CID 138628712) has the molecular formula C25H22FN5O3 and a molecular weight of 459.48 g/mol. Its IUPAC name is 7-amino-1-[4-(2-fluorophenoxy)phenyl]-3-[(3R)-1-prop-2-enoylpyrrolidin-3-yl]-5H-pyrrolo[2,3-d]pyridazin-4-one.
| Compound Name | 7-amino-1-[4-(2-fluorophenoxy)phenyl]-3-[(3R)-1-prop-2-enoylpyrrolidin-3-yl]-5H-pyrrolo[2,3-d]pyridazin-4-one |
|---|---|
| PubChem CID | 138628712 |
| Molecular Formula | C25H22FN5O3 |
| Molecular Weight | 459.48 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | 7-amino-1-[4-(2-fluorophenoxy)phenyl]-3-[(3R)-1-prop-2-enoylpyrrolidin-3-yl]-5H-pyrrolo[2,3-d]pyridazin-4-one |
| SMILES | C=CC(=O)N1CC[C@H](c2cn(-c3ccc(Oc4ccccc4F)cc3)c3c(N)n[nH]c(=O)c23)C1 |
| InChI | InChI=1S/C25H22FN5O3/c1-2-21(32)30-12-11-15(13-30)18-14-31(23-22(18)25(33)29-28-24(23)27)16-7-9-17(10-8-16)34-20-6-4-3-5-19(20)26/h2-10,14-15H,1,11-13H2,(H2,27,28)(H,29,33)/t15-/m0/s1 |
| InChIKey | ZZALUOALNJTPAG-HNNXBMFYSA-N |
| XLogP | 3.73 |
| TPSA | 106.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.48 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|