C8H12N2O — CID 138629171
(2E,4Z)-3-(ethenylamino)-5-(methylamino)penta-2,4-dienal (PubChem CID 138629171) has the molecular formula C8H12N2O and a molecular weight of 152.20 g/mol. Its IUPAC name is (2E,4Z)-3-(ethenylamino)-5-(methylamino)penta-2,4-dienal.
| Compound Name | (2E,4Z)-3-(ethenylamino)-5-(methylamino)penta-2,4-dienal |
|---|---|
| PubChem CID | 138629171 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | (2E,4Z)-3-(ethenylamino)-5-(methylamino)penta-2,4-dienal |
| SMILES | C=CNC(/C=C\NC)=C/C=O |
| InChI | InChI=1S/C8H12N2O/c1-3-10-8(5-7-11)4-6-9-2/h3-7,9-10H,1H2,2H3/b6-4-,8-5+ |
| InChIKey | GTLFRHUWLLYUNF-QXMOYCCXSA-N |
| XLogP | 0.54 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|