C8H8F3N3O3 — CID 138629674
3-oxo-6-(trifluoromethyl)-5,6,7,8-tetrahydro-2H-[1,2,4]triazolo[4,3-a]pyridine-5-carboxylic acid (PubChem CID 138629674) has the molecular formula C8H8F3N3O3 and a molecular weight of 251.16 g/mol. Its IUPAC name is 3-oxo-6-(trifluoromethyl)-5,6,7,8-tetrahydro-2H-[1,2,4]triazolo[4,3-a]pyridine-5-carboxylic acid.
| Compound Name | 3-oxo-6-(trifluoromethyl)-5,6,7,8-tetrahydro-2H-[1,2,4]triazolo[4,3-a]pyridine-5-carboxylic acid |
|---|---|
| PubChem CID | 138629674 |
| Molecular Formula | C8H8F3N3O3 |
| Molecular Weight | 251.16 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 3-oxo-6-(trifluoromethyl)-5,6,7,8-tetrahydro-2H-[1,2,4]triazolo[4,3-a]pyridine-5-carboxylic acid |
| SMILES | O=C(O)C1C(C(F)(F)F)CCc2n[nH]c(=O)n21 |
| InChI | InChI=1S/C8H8F3N3O3/c9-8(10,11)3-1-2-4-12-13-7(17)14(4)5(3)6(15)16/h3,5H,1-2H2,(H,13,17)(H,15,16) |
| InChIKey | MJSQMAGHONGKMG-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.16 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |