C8H11N3O3 — CID 163778896
5-(3-methoxyoxiran-2-yl)-2,5,6,7-tetrahydropyrrolo[2,1-c][1,2,4]triazol-3-one (PubChem CID 163778896) has the molecular formula C8H11N3O3 and a molecular weight of 197.19 g/mol. Its IUPAC name is 5-(3-methoxyoxiran-2-yl)-2,5,6,7-tetrahydropyrrolo[2,1-c][1,2,4]triazol-3-one.
| Compound Name | 5-(3-methoxyoxiran-2-yl)-2,5,6,7-tetrahydropyrrolo[2,1-c][1,2,4]triazol-3-one |
|---|---|
| PubChem CID | 163778896 |
| Molecular Formula | C8H11N3O3 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 5-(3-methoxyoxiran-2-yl)-2,5,6,7-tetrahydropyrrolo[2,1-c][1,2,4]triazol-3-one |
| SMILES | COC1OC1C1CCc2n[nH]c(=O)n21 |
| InChI | InChI=1S/C8H11N3O3/c1-13-7-6(14-7)4-2-3-5-9-10-8(12)11(4)5/h4,6-7H,2-3H2,1H3,(H,10,12) |
| InChIKey | MMWPCVBOILFPOB-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|