C12H11ClFN3O — CID 170345708
5-(3-chloro-5-fluoro-4-methylphenyl)-2,5,6,7-tetrahydropyrrolo[2,1-c][1,2,4]triazol-3-one (PubChem CID 170345708) has the molecular formula C12H11ClFN3O and a molecular weight of 267.69 g/mol. Its IUPAC name is 5-(3-chloro-5-fluoro-4-methylphenyl)-2,5,6,7-tetrahydropyrrolo[2,1-c][1,2,4]triazol-3-one.
| Compound Name | 5-(3-chloro-5-fluoro-4-methylphenyl)-2,5,6,7-tetrahydropyrrolo[2,1-c][1,2,4]triazol-3-one |
|---|---|
| PubChem CID | 170345708 |
| Molecular Formula | C12H11ClFN3O |
| Molecular Weight | 267.69 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 5-(3-chloro-5-fluoro-4-methylphenyl)-2,5,6,7-tetrahydropyrrolo[2,1-c][1,2,4]triazol-3-one |
| SMILES | Cc1c(F)cc(C2CCc3n[nH]c(=O)n32)cc1Cl |
| InChI | InChI=1S/C12H11ClFN3O/c1-6-8(13)4-7(5-9(6)14)10-2-3-11-15-16-12(18)17(10)11/h4-5,10H,2-3H2,1H3,(H,16,18) |
| InChIKey | GPJFHOKJKYTEND-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.69 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |