C12H13ClFN3 — CID 176894347
5-(3-chloro-5-fluoro-4-methylphenyl)-3,5,6,7-tetrahydro-2H-pyrrolo[2,1-c][1,2,4]triazole (PubChem CID 176894347) has the molecular formula C12H13ClFN3 and a molecular weight of 253.71 g/mol. Its IUPAC name is 5-(3-chloro-5-fluoro-4-methylphenyl)-3,5,6,7-tetrahydro-2H-pyrrolo[2,1-c][1,2,4]triazole.
| Compound Name | 5-(3-chloro-5-fluoro-4-methylphenyl)-3,5,6,7-tetrahydro-2H-pyrrolo[2,1-c][1,2,4]triazole |
|---|---|
| PubChem CID | 176894347 |
| Molecular Formula | C12H13ClFN3 |
| Molecular Weight | 253.71 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | 5-(3-chloro-5-fluoro-4-methylphenyl)-3,5,6,7-tetrahydro-2H-pyrrolo[2,1-c][1,2,4]triazole |
| SMILES | Cc1c(F)cc(C2CCC3=NNCN32)cc1Cl |
| InChI | InChI=1S/C12H13ClFN3/c1-7-9(13)4-8(5-10(7)14)11-2-3-12-16-15-6-17(11)12/h4-5,11,15H,2-3,6H2,1H3 |
| InChIKey | DOKNECJYDVPPPQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.71 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |