C21H20Cl3FN2O3 — CID 138632654
N-[3-[2-(4-chloro-2-fluorophenoxy)ethylamino]-3-methylcyclobuten-1-yl]-2-(3,4-dichlorophenoxy)acetamide (PubChem CID 138632654) has the molecular formula C21H20Cl3FN2O3 and a molecular weight of 473.76 g/mol. Its IUPAC name is N-[3-[2-(4-chloro-2-fluorophenoxy)ethylamino]-3-methylcyclobuten-1-yl]-2-(3,4-dichlorophenoxy)acetamide.
| Compound Name | N-[3-[2-(4-chloro-2-fluorophenoxy)ethylamino]-3-methylcyclobuten-1-yl]-2-(3,4-dichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 138632654 |
| Molecular Formula | C21H20Cl3FN2O3 |
| Molecular Weight | 473.76 g/mol |
| Exact Mass | 472.05 |
| IUPAC Name | N-[3-[2-(4-chloro-2-fluorophenoxy)ethylamino]-3-methylcyclobuten-1-yl]-2-(3,4-dichlorophenoxy)acetamide |
| SMILES | CC1(NCCOc2ccc(Cl)cc2F)C=C(NC(=O)COc2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C21H20Cl3FN2O3/c1-21(26-6-7-29-19-5-2-13(22)8-18(19)25)10-14(11-21)27-20(28)12-30-15-3-4-16(23)17(24)9-15/h2-5,8-10,26H,6-7,11-12H2,1H3,(H,27,28) |
| InChIKey | GSIHGCONLPIJDA-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.76 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|