C25H29ClFN3O4 — CID 138632294
N-[3-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-3-methylcyclobuten-1-yl]-2-[2-[4-(dimethylamino)phenyl]ethoxy]acetamide (PubChem CID 138632294) has the molecular formula C25H29ClFN3O4 and a molecular weight of 489.98 g/mol. Its IUPAC name is N-[3-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-3-methylcyclobuten-1-yl]-2-[2-[4-(dimethylamino)phenyl]ethoxy]acetamide.
| Compound Name | N-[3-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-3-methylcyclobuten-1-yl]-2-[2-[4-(dimethylamino)phenyl]ethoxy]acetamide |
|---|---|
| PubChem CID | 138632294 |
| Molecular Formula | C25H29ClFN3O4 |
| Molecular Weight | 489.98 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | N-[3-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-3-methylcyclobuten-1-yl]-2-[2-[4-(dimethylamino)phenyl]ethoxy]acetamide |
| SMILES | CN(C)c1ccc(CCOCC(=O)NC2=CC(C)(NC(=O)COc3ccc(Cl)c(F)c3)C2)cc1 |
| InChI | InChI=1S/C25H29ClFN3O4/c1-25(29-24(32)16-34-20-8-9-21(26)22(27)12-20)13-18(14-25)28-23(31)15-33-11-10-17-4-6-19(7-5-17)30(2)3/h4-9,12-13H,10-11,14-16H2,1-3H3,(H,28,31)(H,29,32) |
| InChIKey | PYQGKYJRKAWVLM-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.98 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|