C24H29ClFN3O4 — CID 145398646
N-[(E)-3-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]but-2-enyl]-2-[2-[4-(dimethylamino)phenyl]ethoxy]acetamide (PubChem CID 145398646) has the molecular formula C24H29ClFN3O4 and a molecular weight of 477.96 g/mol. Its IUPAC name is N-[(E)-3-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]but-2-enyl]-2-[2-[4-(dimethylamino)phenyl]ethoxy]acetamide.
| Compound Name | N-[(E)-3-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]but-2-enyl]-2-[2-[4-(dimethylamino)phenyl]ethoxy]acetamide |
|---|---|
| PubChem CID | 145398646 |
| Molecular Formula | C24H29ClFN3O4 |
| Molecular Weight | 477.96 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | N-[(E)-3-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]but-2-enyl]-2-[2-[4-(dimethylamino)phenyl]ethoxy]acetamide |
| SMILES | C/C(=C\CNC(=O)COCCc1ccc(N(C)C)cc1)NC(=O)COc1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C24H29ClFN3O4/c1-17(28-24(31)16-33-20-8-9-21(25)22(26)14-20)10-12-27-23(30)15-32-13-11-18-4-6-19(7-5-18)29(2)3/h4-10,14H,11-13,15-16H2,1-3H3,(H,27,30)(H,28,31)/b17-10+ |
| InChIKey | SXZCXPZLBCTYPK-LICLKQGHSA-N |
| XLogP | 3.32 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.96 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|