C23H29FIN3O4 — CID 138632703
[1-[[2-[4-(dimethylamino)phenyl]acetyl]amino]-4-[[2-(3-fluoro-4-methylphenoxy)acetyl]amino]butan-2-yl] hypoiodite (PubChem CID 138632703) has the molecular formula C23H29FIN3O4 and a molecular weight of 557.40 g/mol. Its IUPAC name is [1-[[2-[4-(dimethylamino)phenyl]acetyl]amino]-4-[[2-(3-fluoro-4-methylphenoxy)acetyl]amino]butan-2-yl] hypoiodite.
| Compound Name | [1-[[2-[4-(dimethylamino)phenyl]acetyl]amino]-4-[[2-(3-fluoro-4-methylphenoxy)acetyl]amino]butan-2-yl] hypoiodite |
|---|---|
| PubChem CID | 138632703 |
| Molecular Formula | C23H29FIN3O4 |
| Molecular Weight | 557.40 g/mol |
| Exact Mass | 557.12 |
| IUPAC Name | [1-[[2-[4-(dimethylamino)phenyl]acetyl]amino]-4-[[2-(3-fluoro-4-methylphenoxy)acetyl]amino]butan-2-yl] hypoiodite |
| SMILES | Cc1ccc(OCC(=O)NCCC(CNC(=O)Cc2ccc(N(C)C)cc2)OI)cc1F |
| InChI | InChI=1S/C23H29FIN3O4/c1-16-4-9-19(13-21(16)24)31-15-23(30)26-11-10-20(32-25)14-27-22(29)12-17-5-7-18(8-6-17)28(2)3/h4-9,13,20H,10-12,14-15H2,1-3H3,(H,26,30)(H,27,29) |
| InChIKey | NWCMLTWYIQBBJX-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|