C17H15NO7S — CID 138633783
2-[(9-sulfofluoren-9-yl)methoxycarbonylamino]acetic acid (PubChem CID 138633783) has the molecular formula C17H15NO7S and a molecular weight of 377.37 g/mol. Its IUPAC name is 2-[(9-sulfofluoren-9-yl)methoxycarbonylamino]acetic acid.
| Compound Name | 2-[(9-sulfofluoren-9-yl)methoxycarbonylamino]acetic acid |
|---|---|
| PubChem CID | 138633783 |
| Molecular Formula | C17H15NO7S |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | 2-[(9-sulfofluoren-9-yl)methoxycarbonylamino]acetic acid |
| SMILES | O=C(O)CNC(=O)OCC1(S(=O)(=O)O)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C17H15NO7S/c19-15(20)9-18-16(21)25-10-17(26(22,23)24)13-7-3-1-5-11(13)12-6-2-4-8-14(12)17/h1-8H,9-10H2,(H,18,21)(H,19,20)(H,22,23,24) |
| InChIKey | HKZKIHPKAUJPRD-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|