C42H37NO — CID 138636147
(2Z)-4-cyclohexa-2,4-dien-1-yl-1-[4-[2-(9-phenylxanthen-9-yl)cyclohexa-1,3-dien-1-yl]phenyl]penta-2,4-dien-1-amine (PubChem CID 138636147) has the molecular formula C42H37NO and a molecular weight of 571.76 g/mol. Its IUPAC name is (2Z)-4-cyclohexa-2,4-dien-1-yl-1-[4-[2-(9-phenylxanthen-9-yl)cyclohexa-1,3-dien-1-yl]phenyl]penta-2,4-dien-1-amine.
| Compound Name | (2Z)-4-cyclohexa-2,4-dien-1-yl-1-[4-[2-(9-phenylxanthen-9-yl)cyclohexa-1,3-dien-1-yl]phenyl]penta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 138636147 |
| Molecular Formula | C42H37NO |
| Molecular Weight | 571.76 g/mol |
| Exact Mass | 571.29 |
| IUPAC Name | (2Z)-4-cyclohexa-2,4-dien-1-yl-1-[4-[2-(9-phenylxanthen-9-yl)cyclohexa-1,3-dien-1-yl]phenyl]penta-2,4-dien-1-amine |
| SMILES | C=C(/C=C\C(N)c1ccc(C2=C(C3(c4ccccc4)c4ccccc4Oc4ccccc43)C=CCC2)cc1)C1C=CC=CC1 |
| InChI | InChI=1S/C42H37NO/c1-30(31-14-4-2-5-15-31)24-29-39(43)33-27-25-32(26-28-33)35-18-8-9-19-36(35)42(34-16-6-3-7-17-34)37-20-10-12-22-40(37)44-41-23-13-11-21-38(41)42/h2-7,9-14,16-17,19-29,31,39H,1,8,15,18,43H2/b29-24- |
| InChIKey | KUJWVSWIAZJWRQ-OLFWJLLRSA-N |
| XLogP | 10.18 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.76 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|