C46H38N2O2 — CID 142561172
N'-(cyclohexa-2,4-dien-1-ylmethyl)-2-(8,8-diphenyl-5a,12c-dihydroindeno[1,2-a]oxanthren-4-yl)-N-methylidenecyclohexa-1,5-diene-1-carboximidamide (PubChem CID 142561172) has the molecular formula C46H38N2O2 and a molecular weight of 650.82 g/mol. Its IUPAC name is N'-(cyclohexa-2,4-dien-1-ylmethyl)-2-(8,8-diphenyl-5a,12c-dihydroindeno[1,2-a]oxanthren-4-yl)-N-methylidenecyclohexa-1,5-diene-1-carboximidamide.
| Compound Name | N'-(cyclohexa-2,4-dien-1-ylmethyl)-2-(8,8-diphenyl-5a,12c-dihydroindeno[1,2-a]oxanthren-4-yl)-N-methylidenecyclohexa-1,5-diene-1-carboximidamide |
|---|---|
| PubChem CID | 142561172 |
| Molecular Formula | C46H38N2O2 |
| Molecular Weight | 650.82 g/mol |
| Exact Mass | 650.29 |
| IUPAC Name | N'-(cyclohexa-2,4-dien-1-ylmethyl)-2-(8,8-diphenyl-5a,12c-dihydroindeno[1,2-a]oxanthren-4-yl)-N-methylidenecyclohexa-1,5-diene-1-carboximidamide |
| SMILES | C=N/C(=N/CC1C=CC=CC1)C1=C(c2cccc3c2OC2C=CC4=C(c5ccccc5C4(c4ccccc4)c4ccccc4)C2O3)CCC=C1 |
| InChI | InChI=1S/C46H38N2O2/c1-47-45(48-30-31-16-5-2-6-17-31)36-23-12-11-22-34(36)35-25-15-27-40-43(35)49-41-29-28-39-42(44(41)50-40)37-24-13-14-26-38(37)46(39,32-18-7-3-8-19-32)33-20-9-4-10-21-33/h2-10,12-16,18-21,23-29,31,41,44H,1,11,17,22,30H2/b48-45+ |
| InChIKey | KOJKYSCUKLXUSS-YRBWTHCGSA-N |
| XLogP | 9.90 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.82 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|