C15H19N3OS — CID 138637555
6-[(2-methyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-5-yl)sulfanyl]-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 138637555) has the molecular formula C15H19N3OS and a molecular weight of 289.40 g/mol. Its IUPAC name is 6-[(2-methyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-5-yl)sulfanyl]-3,4-dihydro-2H-1,4-benzoxazine.
| Compound Name | 6-[(2-methyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-5-yl)sulfanyl]-3,4-dihydro-2H-1,4-benzoxazine |
|---|---|
| PubChem CID | 138637555 |
| Molecular Formula | C15H19N3OS |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 6-[(2-methyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-5-yl)sulfanyl]-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | CN1CC2=C(C1)CN(Sc1ccc3c(c1)NCCO3)C2 |
| InChI | InChI=1S/C15H19N3OS/c1-17-7-11-9-18(10-12(11)8-17)20-13-2-3-15-14(6-13)16-4-5-19-15/h2-3,6,16H,4-5,7-10H2,1H3 |
| InChIKey | QTRZFSFCOGIART-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|