C50H35N3OS2 — CID 138638442
4-[4-[4,4-bis(4-methylphenyl)-6-(N-phenylanilino)indeno[1,2-b]thiophen-2-yl]-2,1,3-benzothiadiazol-7-yl]benzaldehyde (PubChem CID 138638442) has the molecular formula C50H35N3OS2 and a molecular weight of 757.98 g/mol. Its IUPAC name is 4-[4-[4,4-bis(4-methylphenyl)-6-(N-phenylanilino)indeno[1,2-b]thiophen-2-yl]-2,1,3-benzothiadiazol-7-yl]benzaldehyde.
| Compound Name | 4-[4-[4,4-bis(4-methylphenyl)-6-(N-phenylanilino)indeno[1,2-b]thiophen-2-yl]-2,1,3-benzothiadiazol-7-yl]benzaldehyde |
|---|---|
| PubChem CID | 138638442 |
| Molecular Formula | C50H35N3OS2 |
| Molecular Weight | 757.98 g/mol |
| Exact Mass | 757.22 |
| IUPAC Name | 4-[4-[4,4-bis(4-methylphenyl)-6-(N-phenylanilino)indeno[1,2-b]thiophen-2-yl]-2,1,3-benzothiadiazol-7-yl]benzaldehyde |
| SMILES | Cc1ccc(C2(c3ccc(C)cc3)c3cc(N(c4ccccc4)c4ccccc4)ccc3-c3sc(-c4ccc(-c5ccc(C=O)cc5)c5nsnc45)cc32)cc1 |
| InChI | InChI=1S/C50H35N3OS2/c1-32-13-21-36(22-14-32)50(37-23-15-33(2)16-24-37)44-29-40(53(38-9-5-3-6-10-38)39-11-7-4-8-12-39)25-26-42(44)49-45(50)30-46(55-49)43-28-27-41(47-48(43)52-56-51-47)35-19-17-34(31-54)18-20-35/h3-31H,1-2H3 |
| InChIKey | DDNMLDVTXXLZHC-UHFFFAOYSA-N |
| XLogP | 13.35 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.98 |
| LogP ≤ 5 | 13.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|