C9H18F3NO — CID 138642088
1-[[(2S)-2-methylbutyl]-(2,2,2-trifluoroethyl)amino]ethanol (PubChem CID 138642088) has the molecular formula C9H18F3NO and a molecular weight of 213.24 g/mol. Its IUPAC name is 1-[[(2S)-2-methylbutyl]-(2,2,2-trifluoroethyl)amino]ethanol.
| Compound Name | 1-[[(2S)-2-methylbutyl]-(2,2,2-trifluoroethyl)amino]ethanol |
|---|---|
| PubChem CID | 138642088 |
| Molecular Formula | C9H18F3NO |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 1-[[(2S)-2-methylbutyl]-(2,2,2-trifluoroethyl)amino]ethanol |
| SMILES | CC[C@H](C)CN(CC(F)(F)F)C(C)O |
| InChI | InChI=1S/C9H18F3NO/c1-4-7(2)5-13(8(3)14)6-9(10,11)12/h7-8,14H,4-6H2,1-3H3/t7-,8?/m0/s1 |
| InChIKey | PJICMASONVDMRV-JAMMHHFISA-N |
| XLogP | 2.24 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|