C13H24FN3 — CID 138645908
3-(aminomethyl)-4-N-[2-(cyclobuten-1-yl)-2-fluoroethyl]-2-N-methylpent-1-ene-2,4-diamine (PubChem CID 138645908) has the molecular formula C13H24FN3 and a molecular weight of 241.35 g/mol. Its IUPAC name is 3-(aminomethyl)-4-N-[2-(cyclobuten-1-yl)-2-fluoroethyl]-2-N-methylpent-1-ene-2,4-diamine.
| Compound Name | 3-(aminomethyl)-4-N-[2-(cyclobuten-1-yl)-2-fluoroethyl]-2-N-methylpent-1-ene-2,4-diamine |
|---|---|
| PubChem CID | 138645908 |
| Molecular Formula | C13H24FN3 |
| Molecular Weight | 241.35 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | 3-(aminomethyl)-4-N-[2-(cyclobuten-1-yl)-2-fluoroethyl]-2-N-methylpent-1-ene-2,4-diamine |
| SMILES | C=C(NC)C(CN)C(C)NCC(F)C1=CCC1 |
| InChI | InChI=1S/C13H24FN3/c1-9(16-3)12(7-15)10(2)17-8-13(14)11-5-4-6-11/h5,10,12-13,16-17H,1,4,6-8,15H2,2-3H3 |
| InChIKey | DELULSFAQRKUIH-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.35 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|