C20H18BrClFN3O — CID 138646578
(3'R)-3'-(2-bromo-3-fluoro-4-pyridinyl)-6-chloro-1'-(cyclopropylmethyl)spiro[1H-indole-3,2'-pyrrolidine]-2-one (PubChem CID 138646578) has the molecular formula C20H18BrClFN3O and a molecular weight of 450.74 g/mol. Its IUPAC name is (3'R)-3'-(2-bromo-3-fluoro-4-pyridinyl)-6-chloro-1'-(cyclopropylmethyl)spiro[1H-indole-3,2'-pyrrolidine]-2-one.
| Compound Name | (3'R)-3'-(2-bromo-3-fluoro-4-pyridinyl)-6-chloro-1'-(cyclopropylmethyl)spiro[1H-indole-3,2'-pyrrolidine]-2-one |
|---|---|
| PubChem CID | 138646578 |
| Molecular Formula | C20H18BrClFN3O |
| Molecular Weight | 450.74 g/mol |
| Exact Mass | 449.03 |
| IUPAC Name | (3'R)-3'-(2-bromo-3-fluoro-4-pyridinyl)-6-chloro-1'-(cyclopropylmethyl)spiro[1H-indole-3,2'-pyrrolidine]-2-one |
| SMILES | O=C1Nc2cc(Cl)ccc2C12[C@@H](c1ccnc(Br)c1F)CCN2CC1CC1 |
| InChI | InChI=1S/C20H18BrClFN3O/c21-18-17(23)13(5-7-24-18)14-6-8-26(10-11-1-2-11)20(14)15-4-3-12(22)9-16(15)25-19(20)27/h3-5,7,9,11,14H,1-2,6,8,10H2,(H,25,27)/t14-,20?/m1/s1 |
| InChIKey | ZMRUDYHKLIVRAD-QMRFKDRMSA-N |
| XLogP | 4.68 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.74 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|