C26H22Cl3FN2 — CID 138652572
N-[1-[2,2-dichloro-3-(3-chlorophenyl)cyclopropyl]ethenyl]-4-fluoro-3-[1-(N-methylanilino)ethenyl]aniline (PubChem CID 138652572) has the molecular formula C26H22Cl3FN2 and a molecular weight of 487.83 g/mol. Its IUPAC name is N-[1-[2,2-dichloro-3-(3-chlorophenyl)cyclopropyl]ethenyl]-4-fluoro-3-[1-(N-methylanilino)ethenyl]aniline.
| Compound Name | N-[1-[2,2-dichloro-3-(3-chlorophenyl)cyclopropyl]ethenyl]-4-fluoro-3-[1-(N-methylanilino)ethenyl]aniline |
|---|---|
| PubChem CID | 138652572 |
| Molecular Formula | C26H22Cl3FN2 |
| Molecular Weight | 487.83 g/mol |
| Exact Mass | 486.08 |
| IUPAC Name | N-[1-[2,2-dichloro-3-(3-chlorophenyl)cyclopropyl]ethenyl]-4-fluoro-3-[1-(N-methylanilino)ethenyl]aniline |
| SMILES | C=C(Nc1ccc(F)c(C(=C)N(C)c2ccccc2)c1)C1C(c2cccc(Cl)c2)C1(Cl)Cl |
| InChI | InChI=1S/C26H22Cl3FN2/c1-16(24-25(26(24,28)29)18-8-7-9-19(27)14-18)31-20-12-13-23(30)22(15-20)17(2)32(3)21-10-5-4-6-11-21/h4-15,24-25,31H,1-2H2,3H3 |
| InChIKey | CBLXGFYOMLWTGB-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.83 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|