C20H17Cl4N — CID 138653788
4-chloro-N-[1-[2,2-dichloro-3-(3-chloro-5-ethenylphenyl)cyclopropyl]ethenyl]-3-methylaniline (PubChem CID 138653788) has the molecular formula C20H17Cl4N and a molecular weight of 413.18 g/mol. Its IUPAC name is 4-chloro-N-[1-[2,2-dichloro-3-(3-chloro-5-ethenylphenyl)cyclopropyl]ethenyl]-3-methylaniline.
| Compound Name | 4-chloro-N-[1-[2,2-dichloro-3-(3-chloro-5-ethenylphenyl)cyclopropyl]ethenyl]-3-methylaniline |
|---|---|
| PubChem CID | 138653788 |
| Molecular Formula | C20H17Cl4N |
| Molecular Weight | 413.18 g/mol |
| Exact Mass | 411.01 |
| IUPAC Name | 4-chloro-N-[1-[2,2-dichloro-3-(3-chloro-5-ethenylphenyl)cyclopropyl]ethenyl]-3-methylaniline |
| SMILES | C=Cc1cc(Cl)cc(C2C(C(=C)Nc3ccc(Cl)c(C)c3)C2(Cl)Cl)c1 |
| InChI | InChI=1S/C20H17Cl4N/c1-4-13-8-14(10-15(21)9-13)19-18(20(19,23)24)12(3)25-16-5-6-17(22)11(2)7-16/h4-10,18-19,25H,1,3H2,2H3 |
| InChIKey | OMTORAWZUBSPID-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.18 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|