C28H29Cl2N — CID 134441610
N-[1-[2,2-dichloro-3-(3,4-dimethylphenyl)cyclopropyl]ethenyl]-3-(2,4-dimethylphenyl)-4-methylaniline (PubChem CID 134441610) has the molecular formula C28H29Cl2N and a molecular weight of 450.45 g/mol. Its IUPAC name is N-[1-[2,2-dichloro-3-(3,4-dimethylphenyl)cyclopropyl]ethenyl]-3-(2,4-dimethylphenyl)-4-methylaniline.
| Compound Name | N-[1-[2,2-dichloro-3-(3,4-dimethylphenyl)cyclopropyl]ethenyl]-3-(2,4-dimethylphenyl)-4-methylaniline |
|---|---|
| PubChem CID | 134441610 |
| Molecular Formula | C28H29Cl2N |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | N-[1-[2,2-dichloro-3-(3,4-dimethylphenyl)cyclopropyl]ethenyl]-3-(2,4-dimethylphenyl)-4-methylaniline |
| SMILES | C=C(Nc1ccc(C)c(-c2ccc(C)cc2C)c1)C1C(c2ccc(C)c(C)c2)C1(Cl)Cl |
| InChI | InChI=1S/C28H29Cl2N/c1-16-7-12-24(20(5)13-16)25-15-23(11-9-18(25)3)31-21(6)26-27(28(26,29)30)22-10-8-17(2)19(4)14-22/h7-15,26-27,31H,6H2,1-5H3 |
| InChIKey | SBIVMPAHFPRDER-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|