C27H28ClFN2 — CID 138653566
3-(4-amino-2-methylphenyl)-N-[1-[2-chloro-3-(4-fluoro-3-methylphenyl)-2-methylcyclopropyl]ethenyl]-4-methylaniline (PubChem CID 138653566) has the molecular formula C27H28ClFN2 and a molecular weight of 434.99 g/mol. Its IUPAC name is 3-(4-amino-2-methylphenyl)-N-[1-[2-chloro-3-(4-fluoro-3-methylphenyl)-2-methylcyclopropyl]ethenyl]-4-methylaniline.
| Compound Name | 3-(4-amino-2-methylphenyl)-N-[1-[2-chloro-3-(4-fluoro-3-methylphenyl)-2-methylcyclopropyl]ethenyl]-4-methylaniline |
|---|---|
| PubChem CID | 138653566 |
| Molecular Formula | C27H28ClFN2 |
| Molecular Weight | 434.99 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | 3-(4-amino-2-methylphenyl)-N-[1-[2-chloro-3-(4-fluoro-3-methylphenyl)-2-methylcyclopropyl]ethenyl]-4-methylaniline |
| SMILES | C=C(Nc1ccc(C)c(-c2ccc(N)cc2C)c1)C1C(c2ccc(F)c(C)c2)C1(C)Cl |
| InChI | InChI=1S/C27H28ClFN2/c1-15-6-9-21(14-23(15)22-10-8-20(30)13-16(22)2)31-18(4)25-26(27(25,5)28)19-7-11-24(29)17(3)12-19/h6-14,25-26,31H,4,30H2,1-3,5H3 |
| InChIKey | KTRCKXUWRQRNPL-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.99 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|