C26H38N2O6 — CID 138656939
3-[2-[4-[2-[[1-hydroxy-2-[3-(4-methylphenoxy)propoxy]ethyl]amino]ethyl]phenoxy]ethoxy]-N-methylpropanamide (PubChem CID 138656939) has the molecular formula C26H38N2O6 and a molecular weight of 474.60 g/mol. Its IUPAC name is 3-[2-[4-[2-[[1-hydroxy-2-[3-(4-methylphenoxy)propoxy]ethyl]amino]ethyl]phenoxy]ethoxy]-N-methylpropanamide.
| Compound Name | 3-[2-[4-[2-[[1-hydroxy-2-[3-(4-methylphenoxy)propoxy]ethyl]amino]ethyl]phenoxy]ethoxy]-N-methylpropanamide |
|---|---|
| PubChem CID | 138656939 |
| Molecular Formula | C26H38N2O6 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.27 |
| IUPAC Name | 3-[2-[4-[2-[[1-hydroxy-2-[3-(4-methylphenoxy)propoxy]ethyl]amino]ethyl]phenoxy]ethoxy]-N-methylpropanamide |
| SMILES | CNC(=O)CCOCCOc1ccc(CCNC(O)COCCCOc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C26H38N2O6/c1-21-4-8-23(9-5-21)33-16-3-15-32-20-26(30)28-14-12-22-6-10-24(11-7-22)34-19-18-31-17-13-25(29)27-2/h4-11,26,28,30H,3,12-20H2,1-2H3,(H,27,29) |
| InChIKey | PIAOASFMEDKXJZ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 98.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|