C28H42N2O5 — CID 167241916
2-[3-[2-[4-[[1-hydroxy-7-(4-methylphenyl)heptyl]amino]phenoxy]ethoxy]propoxy]-N-methylacetamide (PubChem CID 167241916) has the molecular formula C28H42N2O5 and a molecular weight of 486.65 g/mol. Its IUPAC name is 2-[3-[2-[4-[[1-hydroxy-7-(4-methylphenyl)heptyl]amino]phenoxy]ethoxy]propoxy]-N-methylacetamide.
| Compound Name | 2-[3-[2-[4-[[1-hydroxy-7-(4-methylphenyl)heptyl]amino]phenoxy]ethoxy]propoxy]-N-methylacetamide |
|---|---|
| PubChem CID | 167241916 |
| Molecular Formula | C28H42N2O5 |
| Molecular Weight | 486.65 g/mol |
| Exact Mass | 486.31 |
| IUPAC Name | 2-[3-[2-[4-[[1-hydroxy-7-(4-methylphenyl)heptyl]amino]phenoxy]ethoxy]propoxy]-N-methylacetamide |
| SMILES | CNC(=O)COCCCOCCOc1ccc(NC(O)CCCCCCc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C28H42N2O5/c1-23-10-12-24(13-11-23)8-5-3-4-6-9-27(31)30-25-14-16-26(17-15-25)35-21-20-33-18-7-19-34-22-28(32)29-2/h10-17,27,30-31H,3-9,18-22H2,1-2H3,(H,29,32) |
| InChIKey | JKORZJAPCGXJBA-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.65 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|