C24H21NO3 — CID 138658257
2-[4-methyl-9-oxo-3-(2-phenylethyl)acridin-10-yl]acetic acid (PubChem CID 138658257) has the molecular formula C24H21NO3 and a molecular weight of 371.44 g/mol. Its IUPAC name is 2-[4-methyl-9-oxo-3-(2-phenylethyl)acridin-10-yl]acetic acid.
| Compound Name | 2-[4-methyl-9-oxo-3-(2-phenylethyl)acridin-10-yl]acetic acid |
|---|---|
| PubChem CID | 138658257 |
| Molecular Formula | C24H21NO3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 2-[4-methyl-9-oxo-3-(2-phenylethyl)acridin-10-yl]acetic acid |
| SMILES | Cc1c(CCc2ccccc2)ccc2c(=O)c3ccccc3n(CC(=O)O)c12 |
| InChI | InChI=1S/C24H21NO3/c1-16-18(12-11-17-7-3-2-4-8-17)13-14-20-23(16)25(15-22(26)27)21-10-6-5-9-19(21)24(20)28/h2-10,13-14H,11-12,15H2,1H3,(H,26,27) |
| InChIKey | FFTZFRZLAXUVIQ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|