C22H24N2O2S — CID 143820974
2-[3-[2-[methanethioyl(2-phenylethyl)amino]ethyl]-2-methylindol-1-yl]acetic acid (PubChem CID 143820974) has the molecular formula C22H24N2O2S and a molecular weight of 380.51 g/mol. Its IUPAC name is 2-[3-[2-[methanethioyl(2-phenylethyl)amino]ethyl]-2-methylindol-1-yl]acetic acid.
| Compound Name | 2-[3-[2-[methanethioyl(2-phenylethyl)amino]ethyl]-2-methylindol-1-yl]acetic acid |
|---|---|
| PubChem CID | 143820974 |
| Molecular Formula | C22H24N2O2S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 2-[3-[2-[methanethioyl(2-phenylethyl)amino]ethyl]-2-methylindol-1-yl]acetic acid |
| SMILES | Cc1c(CCN(C=S)CCc2ccccc2)c2ccccc2n1CC(=O)O |
| InChI | InChI=1S/C22H24N2O2S/c1-17-19(20-9-5-6-10-21(20)24(17)15-22(25)26)12-14-23(16-27)13-11-18-7-3-2-4-8-18/h2-10,16H,11-15H2,1H3,(H,25,26) |
| InChIKey | QGSVTOBUEGMEIP-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|