C16H24N2 — CID 170866943
3-(1-ethyl-2-methylindol-3-yl)-N,N-dimethylpropan-1-amine (PubChem CID 170866943) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 3-(1-ethyl-2-methylindol-3-yl)-N,N-dimethylpropan-1-amine.
| Compound Name | 3-(1-ethyl-2-methylindol-3-yl)-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 170866943 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 3-(1-ethyl-2-methylindol-3-yl)-N,N-dimethylpropan-1-amine |
| SMILES | CCn1c(C)c(CCCN(C)C)c2ccccc21 |
| InChI | InChI=1S/C16H24N2/c1-5-18-13(2)14(10-8-12-17(3)4)15-9-6-7-11-16(15)18/h6-7,9,11H,5,8,10,12H2,1-4H3 |
| InChIKey | PGBBEUKIZAXLEM-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|