C34H54N2O4 — CID 138660443
[(3S,6aS,8aS,11S,12aR,14bS)-11-(3-aminopropylcarbamoyl)-4,4,6a,8a,11,14b-hexamethyl-14-oxo-1,2,3,4a,5,6,6b,7,8,9,10,12,12a,14a-tetradecahydropicen-3-yl] acetate (PubChem CID 138660443) has the molecular formula C34H54N2O4 and a molecular weight of 554.82 g/mol. Its IUPAC name is [(3S,6aS,8aS,11S,12aR,14bS)-11-(3-aminopropylcarbamoyl)-4,4,6a,8a,11,14b-hexamethyl-14-oxo-1,2,3,4a,5,6,6b,7,8,9,10,12,12a,14a-tetradecahydropicen-3-yl] acetate.
| Compound Name | [(3S,6aS,8aS,11S,12aR,14bS)-11-(3-aminopropylcarbamoyl)-4,4,6a,8a,11,14b-hexamethyl-14-oxo-1,2,3,4a,5,6,6b,7,8,9,10,12,12a,14a-tetradecahydropicen-3-yl] acetate |
|---|---|
| PubChem CID | 138660443 |
| Molecular Formula | C34H54N2O4 |
| Molecular Weight | 554.82 g/mol |
| Exact Mass | 554.41 |
| IUPAC Name | [(3S,6aS,8aS,11S,12aR,14bS)-11-(3-aminopropylcarbamoyl)-4,4,6a,8a,11,14b-hexamethyl-14-oxo-1,2,3,4a,5,6,6b,7,8,9,10,12,12a,14a-tetradecahydropicen-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)C(CC[C@@]3(C)C4CC[C@@]5(C)CC[C@](C)(C(=O)NCCCN)C[C@H]5C4=CC(=O)C32)C1(C)C |
| InChI | InChI=1S/C34H54N2O4/c1-21(37)40-27-11-14-34(7)26(30(27,2)3)10-13-33(6)23-9-12-31(4)15-16-32(5,29(39)36-18-8-17-35)20-24(31)22(23)19-25(38)28(33)34/h19,23-24,26-28H,8-18,20,35H2,1-7H3,(H,36,39)/t23?,24-,26?,27-,28?,31-,32-,33-,34-/m0/s1 |
| InChIKey | GAQJRJZXVDSXIS-KDAHYDRDSA-N |
| XLogP | 5.97 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.82 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|