C32H49NO4S — CID 163867346
[(3S,4aR,6aS,8aS,11S,12aR,14aS,14bS)-4,4,6a,8a,11,14b-hexamethyl-11-(methylsulfanylcarbamoyl)-14-oxo-1,2,3,4a,5,6,6b,7,8,9,10,12,12a,14a-tetradecahydropicen-3-yl] acetate (PubChem CID 163867346) has the molecular formula C32H49NO4S and a molecular weight of 543.81 g/mol. Its IUPAC name is [(3S,4aR,6aS,8aS,11S,12aR,14aS,14bS)-4,4,6a,8a,11,14b-hexamethyl-11-(methylsulfanylcarbamoyl)-14-oxo-1,2,3,4a,5,6,6b,7,8,9,10,12,12a,14a-tetradecahydropicen-3-yl] acetate.
| Compound Name | [(3S,4aR,6aS,8aS,11S,12aR,14aS,14bS)-4,4,6a,8a,11,14b-hexamethyl-11-(methylsulfanylcarbamoyl)-14-oxo-1,2,3,4a,5,6,6b,7,8,9,10,12,12a,14a-tetradecahydropicen-3-yl] acetate |
|---|---|
| PubChem CID | 163867346 |
| Molecular Formula | C32H49NO4S |
| Molecular Weight | 543.81 g/mol |
| Exact Mass | 543.34 |
| IUPAC Name | [(3S,4aR,6aS,8aS,11S,12aR,14aS,14bS)-4,4,6a,8a,11,14b-hexamethyl-11-(methylsulfanylcarbamoyl)-14-oxo-1,2,3,4a,5,6,6b,7,8,9,10,12,12a,14a-tetradecahydropicen-3-yl] acetate |
| SMILES | CSNC(=O)[C@@]1(C)CC[C@]2(C)CCC3C(=CC(=O)[C@@H]4[C@@]5(C)CC[C@H](OC(C)=O)C(C)(C)[C@@H]5CC[C@@]34C)[C@@H]2C1 |
| InChI | InChI=1S/C32H49NO4S/c1-19(34)37-25-11-14-32(7)24(28(25,2)3)10-13-31(6)21-9-12-29(4)15-16-30(5,27(36)33-38-8)18-22(29)20(21)17-23(35)26(31)32/h17,21-22,24-26H,9-16,18H2,1-8H3,(H,33,36)/t21?,22-,24-,25-,26-,29-,30-,31-,32-/m0/s1 |
| InChIKey | PHTRVFMMWRSHPJ-YHIAQPHYSA-N |
| XLogP | 6.90 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.81 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|