About (2-methylimidazol-1-yl) thiohypochlorite
(2-methylimidazol-1-yl) thiohypochlorite (PubChem CID 138660924) has the molecular formula C4H5ClN2S
and a molecular weight of 148.62 g/mol. Its IUPAC name is (2-methylimidazol-1-yl) thiohypochlorite.
Molecular Properties
| Compound Name | (2-methylimidazol-1-yl) thiohypochlorite |
| PubChem CID | 138660924 |
| Molecular Formula | C4H5ClN2S |
| Molecular Weight | 148.62 g/mol |
| Exact Mass | 147.99 |
| IUPAC Name | (2-methylimidazol-1-yl) thiohypochlorite |
| SMILES | Cc1nccn1SCl |
| InChI | InChI=1S/C4H5ClN2S/c1-4-6-2-3-7(4)8-5/h2-3H,1H3 |
| InChIKey | QWXFSHBKOLGSHK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.62 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-methylimidazol-1-yl) thiohypochlorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylimidazol-1-yl) thiohypochlorite?
The IUPAC name of (2-methylimidazol-1-yl) thiohypochlorite (CID 138660924) is (2-methylimidazol-1-yl) thiohypochlorite.
What is the SMILES notation for (2-methylimidazol-1-yl) thiohypochlorite?
The canonical SMILES for (2-methylimidazol-1-yl) thiohypochlorite is Cc1nccn1SCl.
What is the InChIKey of (2-methylimidazol-1-yl) thiohypochlorite?
The InChIKey is QWXFSHBKOLGSHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5ClN2S/c1-4-6-2-3-7(4)8-5/h2-3H,1H3.
What are the key properties of (2-methylimidazol-1-yl) thiohypochlorite?
(2-methylimidazol-1-yl) thiohypochlorite has a molecular weight of 148.62 g/mol, XLogP of 1.84, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylimidazol-1-yl) thiohypochlorite is sourced from PubChem (CID 138660924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).