About 1-O-(2-fluoro-2-methylpropyl) 2-O-phenyl oxalate
1-O-(2-fluoro-2-methylpropyl) 2-O-phenyl oxalate (PubChem CID 138664640) has the molecular formula C12H13FO4
and a molecular weight of 240.23 g/mol. Its IUPAC name is 1-O-(2-fluoro-2-methylpropyl) 2-O-phenyl oxalate.
Molecular Properties
| Compound Name | 1-O-(2-fluoro-2-methylpropyl) 2-O-phenyl oxalate |
| PubChem CID | 138664640 |
| Molecular Formula | C12H13FO4 |
| Molecular Weight | 240.23 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 1-O-(2-fluoro-2-methylpropyl) 2-O-phenyl oxalate |
| SMILES | CC(C)(F)COC(=O)C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C12H13FO4/c1-12(2,13)8-16-10(14)11(15)17-9-6-4-3-5-7-9/h3-7H,8H2,1-2H3 |
| InChIKey | ATHMGFYWJWBKDE-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.23 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 1-O-(2-fluoro-2-methylpropyl) 2-O-phenyl oxalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-(2-fluoro-2-methylpropyl) 2-O-phenyl oxalate?
The IUPAC name of 1-O-(2-fluoro-2-methylpropyl) 2-O-phenyl oxalate (CID 138664640) is 1-O-(2-fluoro-2-methylpropyl) 2-O-phenyl oxalate.
What is the SMILES notation for 1-O-(2-fluoro-2-methylpropyl) 2-O-phenyl oxalate?
The canonical SMILES for 1-O-(2-fluoro-2-methylpropyl) 2-O-phenyl oxalate is CC(C)(F)COC(=O)C(=O)Oc1ccccc1.
What is the InChIKey of 1-O-(2-fluoro-2-methylpropyl) 2-O-phenyl oxalate?
The InChIKey is ATHMGFYWJWBKDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13FO4/c1-12(2,13)8-16-10(14)11(15)17-9-6-4-3-5-7-9/h3-7H,8H2,1-2H3.
What are the key properties of 1-O-(2-fluoro-2-methylpropyl) 2-O-phenyl oxalate?
1-O-(2-fluoro-2-methylpropyl) 2-O-phenyl oxalate has a molecular weight of 240.23 g/mol, XLogP of 1.88, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-(2-fluoro-2-methylpropyl) 2-O-phenyl oxalate is sourced from PubChem (CID 138664640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).